CAS 2100306-58-7

4,7,10,13-Tetraoxa-17-azaeicosanoic acid, 20-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-16,20-dioxo-, 2,5-dioxo-1-pyrrolidinyl ester

Description:

4,7,10,13-Tetraoxa-17-azaeicosanoic acid, 20-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-16,20-dioxo-, 2,5-dioxo-1-pyrrolidinyl ester is a complex organic compound characterized by its unique structural features, including multiple functional groups such as esters, dioxo groups, and a nitrogen-containing heterocycle. The presence of tetraoxa and aza groups indicates that the molecule contains both oxygen and nitrogen atoms in its backbone, contributing to its potential solubility and reactivity. The dibenzazocin moiety suggests that the compound may exhibit interesting biological activity, possibly related to its interaction with biological targets. Its intricate structure may also imply specific stereochemical configurations that could influence its pharmacological properties. The compound's CAS number, 2100306-58-7, allows for precise identification in chemical databases, facilitating research and development in medicinal chemistry or related fields. Overall, this substance represents a class of compounds that may have applications in drug design or materials science, warranting further investigation into its properties and potential uses.

Formula: C₃₄H₃₉N₃O₁₀

InChI: InChI=1S/C34H39N3O10/c38-30(35-16-13-31(39)36-25-28-7-2-1-5-26(28)9-10-27-6-3-4-8-29(27)36)14-17-43-19-21-45-23-24-46-22-20-44-18-15-34(42)47-37-32(40)11-12-33(37)41/h1-8H,11-25H2,(H,35,38)

InChI key: InChIKey=ZVWIDTHUTOSOEZ-UHFFFAOYSA-N

SMILES: C(CCNC(CCOCCOCCOCCOCCC(ON1C(=O)CCC1=O)=O)=O)(=O)N2C=3C(C#CC=4C(C2)=CC=CC4)=CC=CC3

Synonyms:

• 2,5-Dioxo-1-pyrrolidinyl 20-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-16,20-dioxo-4,7,10,13-tetraoxa-17-azaeicosanoate
• 4,7,10,13-Tetraoxa-17-azaeicosanoic acid, 20-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-16,20-dioxo-, 2,5-dioxo-1-pyrrolidinyl ester

DBCO-NHCO-PEG4-NHS ester

CAS: 2100306-58-7

DBCO-NHCO-PEG4-NHS ester ester is a MMP-2- and cathepsin B- (CatB) cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1].

Formula: C₃₄H₃₉N₃O₁₀

Purity: 98%

Color and Shape: Solid

Molecular weight: 649.69

Ref: TM-T15064