CAS 2100306-65-6

1,1-Dimethylethyl 3-[2-(4-formylphenoxy)ethoxy]propanoate

Description:

1,1-Dimethylethyl 3-[2-(4-formylphenoxy)ethoxy]propanoate, identified by its CAS number 2100306-65-6, is an organic compound characterized by its complex structure, which includes a propanoate moiety and a phenoxy group. This substance features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, potentially influencing its reactivity and solubility. The presence of the formyl group (–CHO) on the phenoxy ring suggests that it may participate in various chemical reactions, such as nucleophilic addition or condensation. The ethoxy linkage indicates that the compound may exhibit moderate polarity, affecting its solubility in different solvents. Additionally, the overall structure suggests potential applications in organic synthesis or as an intermediate in the production of more complex molecules. Its specific properties, such as melting point, boiling point, and reactivity, would need to be determined through experimental data, as they are not universally defined and can vary based on environmental conditions and purity.

Formula: C₁₆H₂₂O₅

InChI: InChI=1S/C16H22O5/c1-16(2,3)21-15(18)8-9-19-10-11-20-14-6-4-13(12-17)5-7-14/h4-7,12H,8-11H2,1-3H3

InChI key: InChIKey=HIKDMVVPLDWKAB-UHFFFAOYSA-N

SMILES: O(CCOCCC(OC(C)(C)C)=O)C1=CC=C(C=O)C=C1

Synonyms:

• Propanoic acid, 3-[2-(4-formylphenoxy)ethoxy]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-[2-(4-formylphenoxy)ethoxy]propanoate

Ald-Ph-PEG2-Boc

CAS: 2100306-65-6

Ald-Ph-PEG2-Boc is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₆H₂₂O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 294.34

Ref: TM-T17374