CAS 2100306-68-9

2,5-Dioxo-1-pyrrolidinyl 13-oxo-15-phenyl-4,7,10,14-tetraoxapentadecanoate

Description:

2,5-Dioxo-1-pyrrolidinyl 13-oxo-15-phenyl-4,7,10,14-tetraoxapentadecanoate is a complex organic compound characterized by its unique structural features, including a pyrrolidine ring and multiple oxo (carbonyl) groups. This compound likely exhibits properties typical of diketones and esters, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of carbonyl groups. The presence of a phenyl group suggests possible aromatic interactions, which may influence its solubility and stability. Additionally, the tetraoxapentadecanoate moiety indicates that the compound may have a significant molecular weight and could exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry or materials science. Its specific applications and behavior would depend on its interactions with other molecules, as well as its stability under various conditions. As with many complex organic compounds, understanding its characteristics would require detailed spectroscopic analysis and empirical studies.

Formula: C₂₁H₂₇NO₉

InChI: InChI=1S/C21H27NO9/c23-18-6-7-19(24)22(18)31-21(26)9-11-28-13-15-29-14-12-27-10-8-20(25)30-16-17-4-2-1-3-5-17/h1-5H,6-16H2

InChI key: InChIKey=CLTJKBVGXWAMRC-UHFFFAOYSA-N

SMILES: O(C(CCOCCOCCOCCC(OCC1=CC=CC=C1)=O)=O)N2C(=O)CCC2=O

Synonyms:

• 2,5-Dioxo-1-pyrrolidinyl 13-oxo-15-phenyl-4,7,10,14-tetraoxapentadecanoate
• 4,7,10,14-Tetraoxapentadecanoic acid, 13-oxo-15-phenyl-, 2,5-dioxo-1-pyrrolidinyl ester

Benzyloxy carbonyl-PEG3-NHS ester

CAS: 2100306-68-9

Benzyloxy carbonyl-PEG3-NHS ester is a polyethylene glycol (PEG) derivative compound used as a PROTAC linker in the synthesis of PROTACs[1].

Formula: C₂₁H₂₇NO₉

Purity: 98%

Color and Shape: Solid

Molecular weight: 437.44

Ref: TM-T14544