CAS 2100306-85-0

N-(PEG1-OH)-N-Boc-PEG2-propargyl

Description:

N-(PEG1-OH)-N-Boc-PEG2-propargyl is a synthetic compound characterized by its polyethylene glycol (PEG) backbone, which enhances solubility and biocompatibility. The "N-Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amine, allowing for selective reactions without interfering with the amine functionality. The propargyl group introduces an alkyne functionality, enabling further chemical modifications through click chemistry, particularly with azides, which is valuable in bioconjugation and material science applications. The presence of the hydroxyl (OH) group at one end of the PEG chain contributes to its hydrophilicity, while the Boc group at the other end provides stability and protection during synthesis. This compound is often utilized in drug delivery systems, biomaterials, and the development of functionalized surfaces due to its versatile reactivity and favorable properties. Overall, N-(PEG1-OH)-N-Boc-PEG2-propargyl exemplifies a multifunctional polymer that can be tailored for various applications in chemistry and biomedicine.

Formula: C₁₆H₂₉NO₆

InChI: InChI=1S/C16H29NO6/c1-5-9-20-13-14-22-11-7-17(6-10-21-12-8-18)15(19)23-16(2,3)4/h1,18H,6-14H2,2-4H3

InChI key: InChIKey=YEBWOLWOJRIJNN-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)(CCOCCOCC#C)CCOCCO

Synonyms:

• N-(PEG1-OH)-N-Boc-PEG2-propargyl

tert-Butyl (2-(2-hydroxyethoxy)ethyl)(2-(2-(prop-2-yn-1-yloxy)ethoxy)ethyl)carbamate

CAS: 2100306-85-0

tert-Butyl (2-(2-hydroxyethoxy)ethyl)(2-(2-(prop-2-yn-1-yloxy)ethoxy)ethyl)carbamate

Purity: 95%

Molecular weight: 331.41g/mol

Ref: 54-OR1072808

N-(PEG1-OH)-N-Boc-PEG2-propargyl

CAS: 2100306-85-0

N-(PEG1-OH)-N-Boc-PEG2-propargyl is a polyethylene glycol (PEG)-based linker utilized in the synthesis of proteolysis targeting chimeras (PROTACs)[1].

Formula: C₁₆H₂₉NO₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 331.4

Ref: TM-T16242