CAS 210049-16-4

N-[(2R,3S,4R,5R)-2-(4-aminophenoxy)-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide

Description:

N-[(2R,3S,4R,5R)-2-(4-aminophenoxy)-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide, with the CAS number 210049-16-4, is a chemical compound characterized by its complex structure, which includes a tetrahydropyran ring and multiple functional groups such as an acetamide and hydroxyl groups. This compound is notable for its potential biological activity, particularly in medicinal chemistry, where it may serve as a lead compound for drug development. The presence of the 4-aminophenoxy moiety suggests possible interactions with biological targets, enhancing its pharmacological profile. Its stereochemistry, indicated by the specific R and S configurations, plays a crucial role in determining its biological activity and interaction with enzymes or receptors. Additionally, the hydroxymethyl and dihydroxy groups contribute to its solubility and reactivity, making it a candidate for further research in therapeutic applications. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in the field of chemistry.

Formula: C₁₄H₂₀N₂O₆

InChI: InChI=1/C14H20N2O6/c1-7(18)16-11-13(20)12(19)10(6-17)22-14(11)21-9-4-2-8(15)3-5-9/h2-5,10-14,17,19-20H,6,15H2,1H3,(H,16,18)/t10?,11-,12-,13+,14-/m0/s1

4-Aminophenyl 2-acetamido-2-deoxy-a-D-galactopyranoside hydrochloride

CAS: 210049-16-4

Ref: 7W-GC5863

4-Aminophenyl 2-Acetamido-2-deoxy-α-D-galactopyranoside Hydrochloride

Controlled Product

CAS: 210049-16-4

Applications A galactoside aminodeoxy nitrophenyl used in synthetic preparation.
References Petitou, M., et al.: Carbohydrate Res., 42, 180 (1975),

Formula: C₁₄H₂₀N₂O₆·ClH

Color and Shape: Neat

Molecular weight: 348.78

Ref: TR-A622000

4-Aminophenyl 2-acetamido-2-deoxy-a-D-galactopyranoside HCl

CAS: 210049-16-4

4-Aminophenyl 2-acetamido-2-deoxy-a-D-galactopyranoside HCl is an oligosaccharide that is composed of glucose, galactose, and two amino acids. It has a molecular weight of 496.34 g/mol and a chemical formula of C14H20N2O8. This compound is synthesized by the click modification of 2,5-diaminopyridine with D -galactopyranosyl chloride. The methylation and glycosylation reactions are also performed to produce this compound.

Formula: C₁₄H₂₀N₂O₆·HCl

Purity: Min. 95%

Molecular weight: 348.78 g/mol

Ref: 3D-MA04482