CAS 210049-18-6
:(2S,4S,5S)-2-(4-aminophenoxy)-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol hydrochloride
Description:
The chemical substance known as "(2S,4S,5S)-2-(4-aminophenoxy)-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol hydrochloride" with the CAS number 210049-18-6 is a complex organic compound characterized by its tetrahydropyran structure, which features multiple stereocenters contributing to its specific three-dimensional configuration. This compound contains functional groups such as an amino group and a hydroxymethyl group, which may impart biological activity and solubility properties. The presence of the hydrochloride indicates that it is a salt form, enhancing its stability and solubility in aqueous environments. Its stereochemistry, denoted by the (2S,4S,5S) configuration, suggests that it may interact with biological targets in a specific manner, potentially influencing its pharmacological properties. Such compounds are often studied for their potential therapeutic applications, particularly in fields like medicinal chemistry and drug development. Overall, this substance exemplifies the complexity and diversity of organic molecules used in various scientific applications.
Formula:C12H18ClNO6
InChI:InChI=1/C12H17NO6.ClH/c13-6-1-3-7(4-2-6)18-12-11(17)10(16)9(15)8(5-14)19-12;/h1-4,8-12,14-17H,5,13H2;1H/t8?,9-,10+,11?,12-;/m1./s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
β-D-Mannopyranoside, 4-aminophenyl, hydrochloride (9CI)
CAS:Formula:C12H18ClNO6Color and Shape:SolidMolecular weight:307.72744-Aminophenyl-β-D-mannopyranoside hydrochloride
CAS:4-Aminophenyl-β-D-mannopyranoside hydrochloride
Purity:≥95%Molecular weight:307.73g/mol4-Aminophenyl b-D-mannopyranoside HCl
CAS:4-Aminophenyl b-D-mannopyranoside HCl is a fluorinated sugar that is synthesized from the reaction of 4-aminobenzaldehyde and bromoacetylchloride. This product is a white crystalline solid that has a molecular weight of 396.4 g/mol. The purity of this product is > 98%. The molecular formula of this product is C14H14N2O8 and its structural formula is shown below:Formula:C12H17NO6·HClPurity:Min. 95%Molecular weight:307.73 g/mol



