CAS 210049-20-0

3-{[(5-chloronaphthalen-2-yl)sulfonyl]amino}propan-1-aminium chloride

Description:

3-{[(5-chloronaphthalen-2-yl)sulfonyl]amino}propan-1-aminium chloride is a chemical compound characterized by its complex structure, which includes a naphthalene ring substituted with a chlorine atom and a sulfonamide functional group. The presence of the sulfonyl group indicates that it can participate in various chemical reactions, particularly those involving nucleophiles. The aminium chloride component suggests that the compound is a quaternary ammonium salt, which typically exhibits good solubility in polar solvents and may possess surfactant properties. This compound may also demonstrate biological activity due to its structural features, making it of interest in medicinal chemistry. Its molecular interactions could be influenced by the chlorine substituent and the sulfonamide group, potentially affecting its pharmacokinetics and pharmacodynamics. Overall, this compound's unique characteristics make it a subject of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₁₃H₁₆Cl₂N₂O₂S

InChI: InChI=1/C13H15ClN2O2S.ClH/c14-13-4-1-3-10-9-11(5-6-12(10)13)19(17,18)16-8-2-7-15;/h1,3-6,9,16H,2,7-8,15H2;1H

SMILES: c1cc2cc(ccc2c(c1)Cl)S(=O)(=O)NCCCN.Cl

N-(3-Aminopropyl)-5-chloro-2-naphthalenesulfonamide Hydrochloride

CAS: 210049-20-0

Formula: C₁₃H₁₆Cl₂N₂O₂S

Color and Shape: Solid

Molecular weight: 335.2493

Ref: IN-DA002KJH

N-(3-Aminopropyl)-5-chloronaphthalene-2-sulphonamide hydrochloride

CAS: 210049-20-0

N-(3-Aminopropyl)-5-chloronaphthalene-2-sulphonamide hydrochloride

Purity: ≥95%

Molecular weight: 335.25g/mol

Ref: 54-OR2830T

N-(3-Aminopropyl)-5-chloro-2-naphthalenesulfonamide Hydrochloride

Controlled Product

CAS: 210049-20-0

Applications N-(3-Aminopropyl)-5-chloro-2-naphthalenesulfonamide Hydrochloride (cas# 210049-20-0) is a compound useful in organic synthesis.
References Hidaka, H., et al.: Proc. Nat. Acad. Sci. USA, 78, 4354 (1981)

Formula: C₁₃H₁₅ClN₂O₂S·ClH

Color and Shape: Neat

Molecular weight: 335.25

Ref: TR-A628300