CAS 21007-21-6: iron(3+) dihydrogen chloride 3,3'-(3,7,12,17-tetramethylporphine-21,24-diide-2,18-diyl)dipropanoate
Description:Iron(3+) dihydrogen chloride 3,3'-(3,7,12,17-tetramethylporphine-21,24-diide-2,18-diyl)dipropanoate, identified by its CAS number 21007-21-6, is a complex coordination compound featuring iron in the +3 oxidation state coordinated to a porphyrin derivative. This compound exhibits characteristics typical of metalloporphyrins, including a planar structure and the ability to participate in redox reactions. The presence of the dihydrogen chloride indicates that it may have acidic properties, which can influence its solubility and reactivity in various solvents. The tetramethyl substitution on the porphyrin ring enhances its solubility in organic solvents and may affect its electronic properties, making it suitable for applications in catalysis, sensors, or as a model for biological systems. Additionally, the dipropanoate groups can provide further solubility and stability, potentially allowing for interactions with biological molecules. Overall, this compound exemplifies the intricate relationship between metal ions and organic ligands in coordination chemistry, with implications for both synthetic and biological processes.
Formula:C30H28ClFeN4O4
InChI:InChI=1/C30H30N4O4.ClH.Fe/c1-15-9-20-12-25-17(3)21(5-7-29(35)36)27(33-25)14-28-22(6-8-30(37)38)18(4)26(34-28)13-24-16(2)10-19(32-24)11-23(15)31-20;;/h9-14H,5-8H2,1-4H3,(H4,31,32,33,34,35,36,37,38);1H;/q;;+3/p-3/b19-11-,20-12-,23-11-,24-13-,25-12-,26-13-,27-14-,28-14-;;
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Fe(III) Deuteroporphyrin IX chloride REF: FT-D40654CAS: 21007-21-6 | 95% | To inquire | Mon 31 Mar 25 |

Fe(III) Deuteroporphyrin IX chloride
Ref: FT-D40654
50mg | To inquire | ||
100mg | To inquire |