CAS 2101-86-2
:1-azido-4-methylbenzene
Description:
1-Azido-4-methylbenzene, also known as p-tolyl azide, is an organic compound characterized by the presence of an azide functional group (-N3) attached to a para-methylphenyl structure. It is a colorless to pale yellow liquid with a distinct aromatic odor. This compound is known for its stability under normal conditions but can be sensitive to heat and shock, making it potentially hazardous. The azide group contributes to its reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. 1-Azido-4-methylbenzene is often used in organic synthesis, particularly in the preparation of other azide-containing compounds and in click chemistry applications. It is important to handle this compound with care due to its explosive potential when subjected to certain conditions. Additionally, it is soluble in organic solvents, which facilitates its use in various chemical processes. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C7H7N3
InChI:InChI=1/C7H7N3/c1-6-2-4-7(5-3-6)9-10-8/h2-5H,1H3
SMILES:Cc1ccc(cc1)N=[N+]=[NH-]
Synonyms:- Benzene, 1-azido-4-methyl-
- Toluene, p-azido-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Azidotoluene solution
CAS:4-Azidotoluene solution is a coordination complex that consists of four nitrogen atoms and two amido groups. When it is in the presence of a nucleophile, such as water, the nitrogen atoms are eliminated from the solution as ammonia and azide ions. This reaction occurs through an elimination reaction with a redox potential of -0.2 volts. The nitrogen atoms coordinate to form a complex with another molecule, which can then be used as an efficient method for corrosion inhibition. 4-Azidotoluene solution has been shown to protect against corrosion by forming coordination complexes with metals such as copper, zinc, and aluminum. Crystallography studies have shown that 4-azidotoluene molecules are planar in shape and possess two N-H bonds and two amido groups per molecule.Formula:C7H7N3Purity:Min. 95%Molecular weight:133.15 g/mol

