CAS 2101-88-4
:4-Bromophenyl azide
Description:
4-Bromophenyl azide is an organic compound characterized by the presence of an azide functional group (-N3) attached to a bromophenyl ring. Its molecular formula is C6H4BrN3, indicating the presence of carbon, hydrogen, bromine, and nitrogen atoms. This compound typically appears as a yellow to orange solid and is known for its sensitivity to light and heat, which can lead to decomposition. 4-Bromophenyl azide is utilized in various applications, particularly in organic synthesis and materials science, where it serves as a photoaffinity label or a precursor for the generation of reactive intermediates. The azide group is known for its ability to undergo thermal decomposition, yielding nitrogen gas and reactive species that can participate in further chemical reactions. Safety precautions are essential when handling this compound due to its potential explosiveness and toxicity. Overall, 4-Bromophenyl azide is a valuable compound in the field of chemistry, particularly in the development of new materials and in the study of reaction mechanisms.
Formula:C6H4BrN3
InChI:InChI=1S/C6H4BrN3/c7-5-1-3-6(4-2-5)9-10-8/h1-4H
InChI key:InChIKey=WHSJSMSBFMDFHK-UHFFFAOYSA-N
SMILES:N(=[N+]=[N-])C1=CC=C(Br)C=C1
Synonyms:- 4-Bromophenyl azide
- Benzene, 1-azido-4-bromo-
- p-Azidobromobenzene
- p-Bromophenyl azide
- 1-Azido-4-bromobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzene, 1-azido-4-bromo-
CAS:Formula:C6H4BrN3Purity:98%Color and Shape:LiquidMolecular weight:198.02011-Azido-4-bromobenzene ~0.5M solution in t-butyl methyl ether
CAS:1-Azido-4-bromobenzene is a fine chemical that is used as a building block in organic synthesis. 1-Azido-4-bromobenzene is also used as a speciality chemical and research chemical for the production of other compounds. One of its applications is to be used as a reagent in organic synthesis, and it can be reacted with other compounds to form new structures. 1-Azido-4-bromobenzene can also be used as an intermediate or scaffold for the production of complex molecules. 1-Azido-4-bromobenzene has been assigned CAS No. 21018842.
Formula:C6H4BrN3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:198.02 g/mol


