CAS 21010-06-0
:5-(2-Thienyl)-pentanoic acid
Description:
5-(2-Thienyl)-pentanoic acid, with the CAS number 21010-06-0, is an organic compound characterized by its unique structure that includes a pentanoic acid backbone and a thienyl group. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. This substance typically appears as a solid or liquid, depending on the specific conditions, and is soluble in organic solvents. It exhibits acidic properties due to the carboxylic acid functional group, which can participate in various chemical reactions, including esterification and amidation. The presence of the thienyl group may also impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the compound's molecular structure suggests potential applications in materials science and organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 5-(2-Thienyl)-pentanoic acid is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C9H12O2S
InChI:InChI=1/C9H12O2S/c10-9(11)6-2-1-4-8-5-3-7-12-8/h3,5,7H,1-2,4,6H2,(H,10,11)
SMILES:C(CCC(=O)O)Cc1cccs1
Synonyms:- 5-(2-Thienyl)valeric acid
- 5-(Thiophen-2-Yl)Pentanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-(2-Thienyl)pentanoic acid, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H12O2SPurity:95%Color and Shape:Pale cream to yellow to brown, Crystals or powder or crystalline powderMolecular weight:184.252-Thiophenepentanoic acid
CAS:Formula:C9H12O2SPurity:98%Color and Shape:SolidMolecular weight:184.25545-(Thiophen-2-yl)pentanoic acid
CAS:5-(Thiophen-2-yl)pentanoic acidPurity:98%Molecular weight:184.26g/mol



