CAS 21010-12-8
:2-(5-Chloropentyl)thiophene
Description:
2-(5-Chloropentyl)thiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a pentyl chain substituted at the 2-position of the thiophene ring, along with a chlorine atom at the 5-position, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is likely to exhibit moderate solubility in organic solvents due to its hydrophobic alkyl chain, while being less soluble in water. The chlorine substituent can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, compounds like 2-(5-Chloropentyl)thiophene may have applications in organic electronics, such as in the development of organic semiconductors or photovoltaic materials, due to the electronic properties imparted by the thiophene moiety. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C9H13ClS
InChI:InChI=1S/C9H13ClS/c10-7-3-1-2-5-9-6-4-8-11-9/h4,6,8H,1-3,5,7H2
InChI key:InChIKey=PSAPAAZDXHMESG-UHFFFAOYSA-N
SMILES:C(CCCCCl)C1=CC=CS1
Synonyms:- 2-(5-Chloropentyl)thiophene
- Thiophene, 2-(5-chloropentyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.