CAS 210108-90-0

3aH-Cyclopentacyclododecene-1,2,3a,4,9,10,11,13-octol, 1,2,3,4,5,8,9,10,11,12,13,13a-dodecahydro-2,5,8,8-tetramethyl-12-methylene-, 2,4,9,11,13-pentaacetate 1-benzoate, (1R,2R,3aR,4S,5S,6E,9S,10S,11S,13R,13aS)-

Description:

The chemical substance known as "3aH-Cyclopentacyclododecene-1,2,3a,4,9,10,11,13-octol, 1,2,3,4,5,8,9,10,11,12,13,13a-dodecahydro-2,5,8,8-tetramethyl-12-methylene-, 2,4,9,11,13-pentaacetate 1-benzoate, (1R,2R,3aR,4S,5S,6E,9S,10S,11S,13R,13aS)-" with CAS number 210108-90-0 is a complex organic compound characterized by its intricate polycyclic structure and multiple functional groups. This substance features a dodecahydro framework, indicating a high degree of saturation, and includes several methyl and acetate substituents, which contribute to its chemical reactivity and potential applications. The stereochemistry, denoted by the specific R and S configurations, suggests that the compound may exhibit chiral properties, influencing its interactions in biological systems. Its structural complexity may also imply unique physical properties, such as solubility and melting point, which are essential for understanding its behavior in various chemical environments. Overall, this compound's distinctive characteristics make it of interest in fields such as organic synthesis, medicinal chemistry, and materials science.

Formula: C₃₇H₄₈O₁₄

InChI: InChI=1S/C37H48O14/c1-19-16-17-35(8,9)33(49-24(6)41)28(43)30(47-22(4)39)20(2)29(46-21(3)38)27-32(50-34(44)26-14-12-11-13-15-26)36(10,51-25(7)42)18-37(27,45)31(19)48-23(5)40/h11-17,19,27-33,43,45H,2,18H2,1,3-10H3/b17-16+/t19-,27-,28+,29-,30-,31-,32+,33+,36+,37+/m0/s1

InChI key: InChIKey=FPNGPBYYMDKBKJ-OHGSERNNSA-N

SMILES: O(C(=O)C1=CC=CC=C1)[C@@H]2[C@]3([C@@](O)([C@@H](OC(C)=O)[C@@H](C)/C=C/C(C)(C)[C@H](OC(C)=O)[C@H](O)[C@@H](OC(C)=O)C(=C)[C@@H]3OC(C)=O)C[C@]2(OC(C)=O)C)[H]

Synonyms:

• 3aH-Cyclopentacyclododecene-1,2,3a,4,9,10,11,13-octol, 1,2,3,4,5,8,9,10,11,12,13,13a-dodecahydro-2,5,8,8-tetramethyl-12-methylene-, 2,4,9,11,13-pentaacetate 1-benzoate, (1R,2R,3aR,4S,5S,6E,9S,10S,11S,13R,13aS)-
• Jatrophane 6

Jatrophane VI

CAS: 210108-90-0

Jatrophane VI is a natural product for research related to life sciences. The catalog number is TN4354 and the CAS number is 210108-90-0.

Formula: C₃₇H₄₈O₁₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 716.77

Ref: TM-TN4354

Jatrophane 6

CAS: 210108-90-0

Formula: C₃₇H₄₈O₁₄

Purity: 95%~99%

Molecular weight: 716.777

Ref: BP-SBP03664

Jatrophane 6

CAS: 210108-90-0

Jatrophane 6 is a diterpenoid ester, which is a bioactive compound sourced from the Euphorbia species, a genus of flowering plants widely found in varied climates. This compound is known to exhibit significant biological activities, primarily due to its complex molecular structure that allows it to interact with various cellular pathways.

Formula: C₃₇H₄₈O₁₄

Purity: Min. 95%

Molecular weight: 716.8 g/mol

Ref: 3D-KIA10890