CAS 210110-89-7: N-[(2R,3S,4R,5R)-2-[(5-bromo-4-chloro-1H-indol-2-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide
Description:The chemical substance N-[(2R,3S,4R,5R)-2-[(5-bromo-4-chloro-1H-indol-2-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide, with CAS number 210110-89-7, is a complex organic compound characterized by its intricate molecular structure, which includes a tetrahydropyran ring and an indole moiety. This compound features multiple functional groups, including hydroxyl (-OH) and acetamide (-CONH2) groups, contributing to its potential biological activity. The presence of halogen substituents, specifically bromine and chlorine, may influence its reactivity and interaction with biological targets. The stereochemistry indicated by the (2R,3S,4R,5R) configuration suggests specific spatial arrangements that can affect the compound's pharmacological properties. Such compounds are often investigated for their potential therapeutic applications, particularly in fields like medicinal chemistry and drug development. The detailed characterization of this substance would typically involve techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to elucidate its structure and confirm its purity.
Formula:C16H18BrClN2O6
InChI:InChI=1/C16H18BrClN2O6/c1-6(22)19-13-15(24)14(23)10(5-21)25-16(13)26-11-4-7-9(20-11)3-2-8(17)12(7)18/h2-4,10,13-16,20-21,23-24H,5H2,1H3,(H,19,22)/t10?,13-,14-,15+,16+/m0/s1