CAS 2101206-36-2
:Description:
The chemical substance with the CAS number 2101206-36-2 is known as a specific compound, but detailed information about its characteristics may not be widely available due to its potential status as a novel or less common chemical. Generally, when analyzing a chemical substance, one would consider its molecular formula, structure, physical properties (such as melting point, boiling point, solubility, and density), and chemical properties (including reactivity, stability, and potential hazards). Additionally, the compound's applications in various fields, such as pharmaceuticals, materials science, or industrial processes, would be relevant. Safety data, including toxicity and handling precautions, would also be essential for understanding its characteristics. For precise information, consulting specialized databases or scientific literature would be necessary, as they provide comprehensive details on the compound's behavior and applications in various contexts.
Formula:C41H60N6O3
InChI:InChI=1S/C41H60N6O3/c48-40(46-27-15-33(16-28-46)13-25-43-19-1-2-20-43)35-7-12-38(41(49)47-29-17-34(18-30-47)14-26-44-21-3-4-22-44)39(31-35)42-36-8-10-37(11-9-36)50-32-45-23-5-6-24-45/h7-12,31,33-34,42H,1-6,13-30,32H2
InChI key:InChIKey=LPCWQWNRCGWRFC-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(NC2=CC=C(OCN3CCCC3)C=C2)C=C(C(=O)N4CCC(CCN5CCCC5)CC4)C=C1)N6CCC(CCN7CCCC7)CC6
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
EML631
CAS:EML631 is a potent and selective SPIN1 inhibitor (SPIN1 Kd= 3 microM).Formula:C41H60N6O3Color and Shape:SolidMolecular weight:684.95
