CAS 2101315-36-8: 1H-Benzimidazolium, 2-ethyl-1-methyl-3-[2-[[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl]oxy]-2-oxoethyl]-, chloride (1:1)

Description:1H-Benzimidazolium, 2-ethyl-1-methyl-3-[2-[[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl]oxy]-2-oxoethyl]-, chloride (1:1) is a complex organic compound characterized by its benzimidazolium core, which is a bicyclic structure containing a fused benzene and imidazole ring. This compound features a quaternary ammonium structure due to the presence of a positively charged nitrogen atom, making it a cationic species. The presence of the ethyl and methyl groups contributes to its hydrophobic characteristics, while the cyclohexyl moiety, with its specific stereochemistry, adds to the compound's steric bulk and potential for specific interactions. The chloride ion serves as a counterion, balancing the positive charge of the benzimidazolium. This compound may exhibit interesting properties such as solubility in organic solvents, potential biological activity, and utility in various applications, including catalysis or as an ionic liquid. Its specific interactions and reactivity would depend on the functional groups present and the overall molecular structure.

Formula:C₂₂H₃₃N₂O₂·Cl

InChI:InChI=1S/C22H33N2O2.ClH/c1-6-21-23(5)18-9-7-8-10-19(18)24(21)14-22(25)26-20-13-16(4)11-12-17(20)15(2)3;/h7-10,15-17,20H,6,11-14H2,1-5H3;1H/q+1;/p-1/t16-,17+,20-;/m1./s1

InChI key:InChIKey=UBWVTCCKVGOTBG-VYZBTARASA-M

SMILES:[Cl-].O=C(OC1CC(C)CCC1C(C)C)C[N+]=2C=3C=CC=CC3N(C2CC)C

Synonyms:
1H-Benzimidazolium, 2-ethyl-1-methyl-3-[2-[[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl]oxy]-2-oxoethyl]-, chloride (1:1)
Gboxin

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Gboxin REF: TM-T15373CAS: 2101315-36-8	100% - 99.58%	60.00 €~1,795.00 €	Mon 14 Apr 25
	Gboxin REF: 3D-BG168557CAS: 2101315-36-8	Min. 95%	354.00 €~981.00 €	Wed 23 Apr 25