CAS 210174-74-6
:9,10-Dibromo-2-anthracenesulfonyl chloride
Description:
9,10-Dibromo-2-anthracenesulfonyl chloride is a chemical compound characterized by its structure, which includes an anthracene backbone substituted with bromine and a sulfonyl chloride functional group. This compound typically appears as a solid and is known for its reactivity due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. The bromine atoms enhance its electrophilic character, making it useful in various synthetic applications, particularly in organic synthesis and materials science. It is often employed as a reagent in the preparation of other chemical compounds, including dyes and pharmaceuticals. Additionally, the compound's unique structure contributes to its potential applications in photonic and electronic materials. Safety precautions are essential when handling this substance, as it may pose hazards such as skin and respiratory irritation. Proper storage and disposal methods should be followed to mitigate any environmental impact.
Formula:C14H7Br2ClO2S
InChI:InChI=1S/C14H7Br2ClO2S/c15-13-9-3-1-2-4-10(9)14(16)12-7-8(20(17,18)19)5-6-11(12)13/h1-7H
InChI key:InChIKey=AZFXTUUUGCMHGD-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C(Br)=C3C1C=CC=C3)C=CC(S(Cl)(=O)=O)=C2
Synonyms:- 2-Anthracenesulfonyl chloride, 9,10-dibromo-
- 9,10-Dibromo-2-anthracenesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Anthracenesulfonyl chloride, 9,10-dibromo-
CAS:Formula:C14H7Br2ClO2SColor and Shape:SolidMolecular weight:434.53029,10-Dibromoanthracene-2-sulfonyl Chloride
CAS:Controlled ProductStability Moisture Sensitive
Applications 9,10-Dibromoanthracene-2-sulfonyl Chloride (cas# 210174-74-6) is a compound useful in organic synthesis.Formula:C14H7Br2ClO2SColor and Shape:NeatMolecular weight:434.53

