CAS 2101775-10-2

3-Pyrrolidinemethanol, 4-(trifluoromethyl)-, hydrochloride (1:1), (3R,4R)-

Description:

3-Pyrrolidinemethanol, 4-(trifluoromethyl)-, hydrochloride (1:1), (3R,4R)- is a chemical compound characterized by its pyrrolidine structure, which includes a hydroxymethyl group and a trifluoromethyl substituent at the 4-position. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The (3R,4R) designation indicates the specific stereochemistry of the molecule, which can significantly affect its pharmacological properties and interactions with biological targets. This compound may be of interest in medicinal chemistry and drug development due to its potential therapeutic applications. However, detailed studies on its toxicity, stability, and specific biological activities would be necessary to fully understand its utility in research or clinical settings.

Formula: C₆H₁₀F₃NO·ClH

InChI: InChI=1S/C6H10F3NO.ClH/c7-6(8,9)5-2-10-1-4(5)3-11;/h4-5,10-11H,1-3H2;1H/t4-,5+;/m1./s1

InChI key: InChIKey=GOWTXUHBQKEZEX-JBUOLDKXSA-N

SMILES: [C@@](F)(F)(F)[C@@H]1[C@@H](CO)CNC1.Cl

Synonyms:

• 3-Pyrrolidinemethanol, 4-(trifluoromethyl)-, hydrochloride (1:1), (3R,4R)-

[(3R,4R)-4-(Trifluoromethyl)pyrrolidin-3-yl]methanol hydrochloride

CAS: 2101775-10-2

Formula: C₆H₁₁ClF₃NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 205.6058

Ref: IN-DA00ILCF