CAS 2102-15-0
:Benzonitrile-d5
Description:
Benzonitrile-d5, also known as deuterated benzonitrile, is a chemical compound characterized by the presence of a cyano group (-CN) attached to a benzene ring, with five hydrogen atoms replaced by deuterium isotopes. Its molecular formula is C7D5N, and it is primarily used in NMR spectroscopy as a solvent due to its deuterated nature, which minimizes interference in proton NMR experiments. The presence of deuterium enhances the resolution of spectral data, making it valuable in various analytical applications. Benzonitrile-d5 is a colorless liquid with a characteristic aromatic odor, and it is soluble in organic solvents. Its physical properties, such as boiling point and density, may differ slightly from those of non-deuterated benzonitrile due to the isotopic substitution. As with other nitriles, it can participate in various chemical reactions, including nucleophilic additions and hydrolysis. Safety precautions should be taken when handling this compound, as it may pose health risks similar to those of its non-deuterated counterpart.
Formula:C7D5N
InChI:InChI=1/C7H5N/c8-6-7-4-2-1-3-5-7/h1-5H/i1D,2D,3D,4D,5D
SMILES:c1(c(c(c(c(c1[2H])[2H])C#N)[2H])[2H])[2H]
Synonyms:- (2H5)benzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzonitrile-d5
CAS:Formula:C6D5CNPurity:99 atom % DColor and Shape:Colourless LiquidMolecular weight:108.07358Benzonitrile-D5
CAS:Controlled Product<p>Applications Benzonitrile-D5 is a labelled analogue of benzonitrile, commonly used as a precursor to synthesize a wide range of aromatic compounds and also forms stable coordination complexes with transition metals.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Anderson, G., et al.: Inorg. Syn., 28, 60 (1990); Cui, D., et al.: Angew. Chem. Int. Edit., 117 981 (2005)<br></p>Formula:C7D5NColor and Shape:NeatMolecular weight:108.15



