CAS 2102-75-2

7-Hydroxycadalene

Description:

7-Hydroxycadalene is an organic compound belonging to the class of bicyclic sesquiterpenes. It is characterized by a hydroxyl group (-OH) attached to the cadalene framework, which contributes to its chemical reactivity and potential biological activity. The compound typically exhibits a complex structure with multiple chiral centers, leading to the possibility of stereoisomerism. 7-Hydroxycadalene is known for its aromatic properties, which can influence its solubility and interaction with other substances. It may be found in various natural sources, particularly in certain essential oils and plant extracts, where it can play a role in the plant's defense mechanisms or contribute to its fragrance. The compound's properties, such as boiling point, melting point, and reactivity, can vary based on its purity and the presence of other functional groups. Additionally, research into its potential applications in pharmaceuticals and as a natural product continues, highlighting its significance in both chemistry and biochemistry.

Formula: C₁₅H₁₈O

InChI: InChI=1S/C15H18O/c1-9(2)12-6-5-10(3)13-8-15(16)11(4)7-14(12)13/h5-9,16H,1-4H3

InChI key: InChIKey=RIWNMJBJRPCUBX-UHFFFAOYSA-N

SMILES: C(C)(C)C=1C2=C(C=C(O)C(C)=C2)C(C)=CC1

Synonyms:

• 3,8-Dimethyl-5-(1-methylethyl)-2-naphthalenol
• 7-Hydroxycadalene
• Cadalene, 7-hydroxy-
• 2-Naphthol, 5-isopropyl-3,8-dimethyl-
• 2-Naphthalenol, 3,8-dimethyl-5-(1-methylethyl)-

7-Hydroxycadalene

CAS: 2102-75-2

7-Hydroxycadalene shows cytotoxicity activity against HCT-15 cell line with IC50 18.89 ± 1.2 uM.

Formula: C₁₅H₁₈O

Purity: 98%

Color and Shape: Solid

Molecular weight: 214.3

Ref: TM-TN3235

7-Hydroxycadalene

CAS: 2102-75-2

7-Hydroxycadalene is a sesquiterpene compound, which is a naturally occurring secondary metabolite. It is primarily sourced from various plant species, often found in extracts of the Myrtaceae family. As a sesquiterpene, 7-Hydroxycadalene exhibits a complex structure featuring carbon and hydrogen atoms, along with a hydroxyl group, which plays a critical role in its chemical reactivity and biological interactions.

Formula: C₁₅H₁₈O

Purity: Min. 95%

Molecular weight: 214.30 g/mol

Ref: 3D-CAA10275