
CAS 2102411-81-2
:1-Bromo-7-(trifluoromethyl)-2-naphthalenecarboxaldehyde
Description:
1-Bromo-7-(trifluoromethyl)-2-naphthalenecarboxaldehyde is an organic compound characterized by its complex structure, which includes a naphthalene ring system substituted with a bromine atom and a trifluoromethyl group, as well as an aldehyde functional group. The presence of the bromine atom introduces significant reactivity, making it a useful intermediate in various organic synthesis reactions. The trifluoromethyl group enhances the compound's lipophilicity and can influence its electronic properties, potentially affecting its reactivity and interactions in biological systems. As an aldehyde, it is likely to participate in nucleophilic addition reactions, making it valuable in the synthesis of more complex molecules. The compound's unique combination of functional groups may also impart interesting physical properties, such as solubility in organic solvents and specific spectral characteristics in techniques like NMR and IR spectroscopy. Overall, 1-Bromo-7-(trifluoromethyl)-2-naphthalenecarboxaldehyde serves as a significant building block in medicinal chemistry and materials science.
Formula:C12H6BrF3O
InChI:InChI=1S/C12H6BrF3O/c13-11-8(6-17)2-1-7-3-4-9(5-10(7)11)12(14,15)16/h1-6H
InChI key:InChIKey=WAITWZKADXJEEK-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=CC(C(F)(F)F)=C2)C=CC1C=O
Synonyms:- 2-Naphthalenecarboxaldehyde, 1-bromo-7-(trifluoromethyl)-
- 1-Bromo-7-(trifluoromethyl)-2-naphthalenecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.