CAS 2102412-95-1

3H-Imidazo[4,5-b]pyridine-7-methanamine, hydrochloride (1:2)

Description:

3H-Imidazo[4,5-b]pyridine-7-methanamine, hydrochloride (1:2) is a chemical compound characterized by its imidazo-pyridine structure, which features a fused bicyclic system containing both imidazole and pyridine rings. This compound typically exists as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in medicinal chemistry. The presence of the methanamine group suggests potential reactivity and biological activity, often associated with neurotransmitter modulation or other pharmacological effects. The compound's molecular structure contributes to its unique properties, including its ability to interact with biological targets, which may be of interest in drug development. Additionally, the hydrochloride form can influence the compound's stability and bioavailability. As with many nitrogen-containing heterocycles, it may exhibit diverse chemical reactivity, including nucleophilic substitution and coordination with metal ions. Overall, this compound represents a significant area of interest for researchers exploring new therapeutic agents.

Formula: C₇H₈N₄·2ClH

InChI: InChI=1S/C7H8N4.2ClH/c8-3-5-1-2-9-7-6(5)10-4-11-7;;/h1-2,4H,3,8H2,(H,9,10,11);2*1H

InChI key: InChIKey=AGYRPPMYQMJOCP-UHFFFAOYSA-N

SMILES: C(N)C1=C2C(N=CN2)=NC=C1.Cl

Synonyms:

• 3H-Imidazo[4,5-b]pyridine-7-methanamine, hydrochloride (1:2)

(3H-IMIDAZO[4,5-B]PYRIDIN-7-YLMETHYL)AMINE DIHYDROCHLORIDE

CAS: 2102412-95-1

Formula: C₇H₁₀Cl₂N₄

Purity: 95.0%

Molecular weight: 221.09

Ref: 10-F503334