CAS 2102412-96-2

3-Benzofuranamine, 4-chloro-2,3-dihydro-, hydrochloride (1:1), (3R)-

Description:

3-Benzofuranamine, 4-chloro-2,3-dihydro-, hydrochloride (1:1), (3R)- is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and an amine functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceutical research. The presence of the 4-chloro substituent contributes to its potential biological activity, making it of interest in medicinal chemistry. The (3R)- designation indicates a specific stereochemistry, which can influence the compound's interaction with biological targets, thereby affecting its pharmacological properties. As with many amines, it may exhibit basicity, allowing it to participate in acid-base reactions. The compound's molecular characteristics, including its molecular weight and specific functional groups, play a crucial role in determining its reactivity, stability, and potential applications in drug development or as a research tool in biochemical studies.

Formula: C₈H₈ClNO·ClH

InChI: InChI=1S/C8H8ClNO.ClH/c9-5-2-1-3-7-8(5)6(10)4-11-7;/h1-3,6H,4,10H2;1H/t6-;/m0./s1

InChI key: InChIKey=DGIODMAWMUIYPH-RGMNGODLSA-N

SMILES: ClC1=C2C(=CC=C1)OC[C@@H]2N.Cl

Synonyms:

• 3-Benzofuranamine, 4-chloro-2,3-dihydro-, hydrochloride (1:1), (3R)-

(3R)-4-Chloro-2,3-dihydrobenzo[b]furan-3-ylamine hydrochloride

CAS: 2102412-96-2

Formula: C₈H₉Cl₂NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 206.0692

Ref: IN-DA01DU80

(R)-4-Chloro-2,3-dihydrobenzofuran-3-amine hydrochloride

CAS: 2102412-96-2

(R)-4-Chloro-2,3-dihydrobenzofuran-3-amine hydrochloride

Purity: 97%

Molecular weight: 206.07g/mol

Ref: 54-OR1055921

(3R)-4-CHLORO-2,3-DIHYDROBENZO[B]FURAN-3-YLAMINE HYDROCHLORIDE

CAS: 2102412-96-2

Formula: C₈H₉Cl₂NO

Purity: 95%

Molecular weight: 206.07

Ref: 10-F514422