CAS 21027-01-0
:N-cbz-ala-pro
Description:
N-Cbz-ala-pro, also known as N-carbobenzyloxy-L-alanyl-L-proline, is a peptide derivative characterized by the presence of a carbobenzyloxy (Cbz) protecting group on the amino group of L-alanine (Ala) and a proline (Pro) residue. This compound is typically used in peptide synthesis and research due to its ability to protect the amino group during coupling reactions, facilitating the formation of peptide bonds. The Cbz group is removable under mild acidic conditions, allowing for the selective deprotection of the amino group when needed. N-Cbz-ala-pro is generally stable under standard laboratory conditions but may be sensitive to strong acids or bases. Its structure contributes to its solubility in organic solvents, making it suitable for various synthetic applications. Additionally, the presence of the proline residue can influence the conformation and biological activity of peptides, making N-Cbz-ala-pro a valuable intermediate in the synthesis of bioactive peptides and pharmaceuticals.
Formula:C16H20N2O5
InChI:InChI=1/C16H20N2O5/c1-11(14(19)18-9-5-8-13(18)15(20)21)17-16(22)23-10-12-6-3-2-4-7-12/h2-4,6-7,11,13H,5,8-10H2,1H3,(H,17,22)(H,20,21)
SMILES:CC(C(=O)N1CCCC1C(=O)O)N=C(O)OCc1ccccc1
Synonyms:- Z-Ala-Pro-OH
- N-[(benzyloxy)carbonyl]alanylproline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
L-Proline, N-[(phenylmethoxy)carbonyl]-L-alanyl-
CAS:Formula:C16H20N2O5Purity:98%Color and Shape:SolidMolecular weight:320.3404Z-Ala-Pro-OH
CAS:Z-Ala-Pro-OH is a synthetic, analog substrate for serine proteases. It is used as a target cell for schistosomiasis, which are parasitic worms that infect humans and cause the disease. The molecule is localized in the digestive tract of the parasite, where it has biochemical properties that are analogous to those found in the natural substrate (serine protease) of this organism. Z-Ala-Pro-OH has been shown to inhibit the growth of various species of schistosomes, including Schistosoma mansoni. It also has immunoregulatory properties and can be used to stimulate antibody production by B cells when combined with an antigen.Formula:C16H20N2O5Purity:Min. 95%Molecular weight:320.34 g/mol


