CAS 21027-46-3

Adenosine, adenylyl-(3′→5′)-, ammonium salt

Description:

Adenosine, adenylyl-(3′→5′)-, ammonium salt, commonly known as cyclic adenosine monophosphate (cAMP), is a nucleotide derivative that plays a crucial role in cellular signaling processes. It is characterized by its cyclic structure, which consists of a ribose sugar, a phosphate group, and adenine. The 3′ to 5′ phosphodiester bond in cAMP is essential for its function as a second messenger in various biological pathways, including the regulation of metabolism, gene expression, and cell proliferation. As an ammonium salt, it typically exists in a stable, soluble form, facilitating its interaction with various enzymes and receptors. cAMP is synthesized from ATP by the enzyme adenylate cyclase and is degraded by phosphodiesterases. Its concentration within cells is tightly regulated, reflecting its importance in mediating responses to hormones and neurotransmitters. Overall, cAMP is a vital component in the signaling cascades that govern numerous physiological processes.

Formula: C₂₀H₂₅N₁₀O₁₀P·xH₃N

InChI: InChI=1S/C20H25N10O10P.H3N/c21-15-9-17(25-3-23-15)29(5-27-9)19-12(33)11(32)8(39-19)2-37-41(35,36)40-14-7(1-31)38-20(13(14)34)30-6-28-10-16(22)24-4-26-18(10)30;/h3-8,11-14,19-20,31-34H,1-2H2,(H,35,36)(H2,21,23,25)(H2,22,24,26);1H3/t7-,8-,11-,12-,13-,14-,19-,20-;/m1./s1

InChI key: InChIKey=FGLMYLGQMGLBCT-AHKIGRPSSA-N

SMILES: O[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=CN3)O[C@H](CO)[C@H]1OP(OC[C@H]4O[C@H]([C@H](O)[C@@H]4O)N5C=6C(N=C5)=C(N)N=CN6)(=O)O.N

Synonyms:

• Adenosine, adenylyl-(3′→5′)-, ammonium salt

Adenylyl-3'-5'-adenosine ammonium salt

CAS: 21027-46-3

Adenylyl-3'-5'-adenosine ammonium salt is a novel and activator. CAS No. 21027-46-3. Ribonuclesides, Deoxyribonucleosides, diphosphate, Phosphoramidites, Modified, Anticancer, Antiviral, monophosphate, Nucleosides, Synthetic. High quality and high purity.

Formula: C₂₀H₂₅N₁₀O₁₀P

Purity: Min. 95%

Molecular weight: 596.45 g/mol

Ref: 3D-NA05778