CAS 210297-56-6
:[(3R,4S,5R,6S)-5-allyloxy-3,4-dibenzyloxy-6-methoxy-tetrahydropyran-2-yl]methanol
Description:
The chemical substance with the name "[(3R,4S,5R,6S)-5-allyloxy-3,4-dibenzyloxy-6-methoxy-tetrahydropyran-2-yl]methanol" and CAS number "210297-56-6" is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including allyloxy, dibenzyloxy, and methoxy groups, contributing to its reactivity and potential applications in organic synthesis or medicinal chemistry. The stereochemistry indicated by the R and S designations suggests specific spatial arrangements of the substituents around the chiral centers, which can significantly influence the compound's biological activity and interactions. The presence of the methanol moiety implies that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. Overall, this compound's unique structural features may make it of interest in various fields, including pharmaceuticals, where such derivatives can exhibit diverse biological properties.
Formula:C24H30O6
InChI:InChI=1/C24H30O6/c1-3-14-27-23-22(29-17-19-12-8-5-9-13-19)21(20(15-25)30-24(23)26-2)28-16-18-10-6-4-7-11-18/h3-13,20-25H,1,14-17H2,2H3/t20?,21-,22+,23-,24+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-D-Mannopyranoside, methyl 3,4-bis-O-(phenylmethyl)-2-O-2-propen-1-yl-
CAS:Formula:C24H30O6Molecular weight:414.4914Methyl 2-O-allyl-3,4-di-O-benzyl-a-D-mannopyranoside
CAS:<p>Methyl 2-O-allyl-3,4-di-O-benzyl-a-D-mannopyranoside is an organic compound that belongs to the group of Modification. It is a modified oligosaccharide with a molecular weight of 690.3 g/mol. The modification is an Oligosaccharide, Carbohydrate, complex carbohydrate, Custom synthesis, Synthetic. CAS No. 210297-56-6, High purity, Monosaccharide, Methylation, Glycosylation and Polysaccharide. This molecule has a monosaccharide with the chemical formula C5H11NO5 and a molecular weight of 131.2 g/mol. The fluorination and saccharides are Fluorination and saccharides respectively.</p>Formula:C24H30O6Purity:Min. 95%Molecular weight:414.49 g/mol


