CAS 2103-94-8
:2-Amino-4-(4-bromophenyl)thiazole
Description:
2-Amino-4-(4-bromophenyl)thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an amino group (-NH2) and a bromophenyl substituent, which contributes to its chemical reactivity and potential biological activity. The presence of the bromine atom enhances its lipophilicity and can influence its interaction with biological targets. Typically, thiazole derivatives exhibit a range of pharmacological properties, including antimicrobial and anticancer activities. The compound's molecular structure allows for various synthetic modifications, making it a valuable intermediate in organic synthesis and medicinal chemistry. Its solubility and stability can vary depending on the solvent and conditions, which are important factors to consider in practical applications. Overall, 2-Amino-4-(4-bromophenyl)thiazole represents a significant class of compounds with diverse applications in research and industry.
Formula:C9H7BrN2S
InChI:InChI=1/C9H7BrN2S/c10-7-3-1-6(2-4-7)8-5-13-9(11)12-8/h1-5H,(H2,11,12)
SMILES:c1cc(ccc1c1csc(=N)[nH]1)Br
Synonyms:- 2-Thiazolamine, 4-(4-bromophenyl)-
- 4-(4-Bromophenyl)-1,3-thiazol-2-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-4-(4-bromophenyl)thiazole
CAS:Formula:C9H7BrN2SPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:255.132-Thiazolamine, 4-(4-bromophenyl)-
CAS:Formula:C9H7BrN2SPurity:98%Color and Shape:SolidMolecular weight:255.13432-Amino-4-(4-bromophenyl)-1,3-thiazole
CAS:2-Amino-4-(4-bromophenyl)-1,3-thiazoleFormula:C9H7BrN2SPurity:98%Color and Shape: pale yellow solidMolecular weight:255.13g/mol2-Amino-4-(4′-bromophenyl)-1,3-thiazole
CAS:Formula:C9H7BrN2SPurity:98%Color and Shape:SolidMolecular weight:255.132-Amino-4-(4-bromophenyl)thiazole
CAS:2-Amino-4-(4-bromophenyl)thiazole is a broad-spectrum antibiotic that inhibits bacterial growth by binding to the enzyme fatty acid synthase. This active form of 2-amino-4-(4-bromophenyl)thiazole inhibits the production of fatty acids, which are essential for the synthesis of cell membranes and other cellular structures. 2-Amino-4-(4-bromophenyl)thiazole is also able to inhibit bacterial growth by inhibiting the activity of fatty acid biosynthesis enzymes, such as 3 beta hydroxysteroid dehydrogenase, acetate kinase, and acetyl coenzyme A (acetyl CoA).
Formula:C9H7BrN2SPurity:Min. 95%Color and Shape:PowderMolecular weight:255.14 g/mol




