CAS 2103-99-3
:2-amino-4-(4-chlorophenyl)thiazole
Description:
2-Amino-4-(4-chlorophenyl)thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of an amino group (-NH2) at the 2-position and a para-chlorophenyl group at the 4-position contributes to its chemical reactivity and potential biological activity. This compound typically appears as a solid and is soluble in polar organic solvents. It may exhibit properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. The thiazole moiety is known for its role in various biological systems and can participate in diverse chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the chlorophenyl substituent can influence the compound's electronic properties and interactions with biological targets. Overall, 2-amino-4-(4-chlorophenyl)thiazole is a compound of interest in medicinal chemistry and material science due to its unique structural features and potential applications.
Formula:C9H7ClN2S
InChI:InChI=1/C9H7ClN2S/c10-7-3-1-6(2-4-7)8-5-13-9(11)12-8/h1-5H,(H2,11,12)
InChI key:InChIKey=DWGWNNCHJPKZNC-UHFFFAOYSA-N
SMILES:c1cc(ccc1c1csc(=N)[nH]1)Cl
Synonyms:- 2-Amino-4-(p-chlorophenyl)thiazole
- 2-Thiazolamine, 4-(4-chlorophenyl)-
- 4-(4-Chlorophenyl)-1,3-Thiazol-2-Amine
- 4-(4-Chlorophenyl)-2-aminothiazole
- 4-(4-Chlorophenyl)-2-thiazolamine
- 4-(4-Chlorophenyl)Thiazol-2-Amine
- 4-(4-Chlorophenyl)thiazol-2-ylamine
- 4-(p-Chlorophenyl)-2-aminothiazole
- NSC 372682
- T 157602
- Thiazole, 2-amino-4-(p-chlorophenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Amino-4-(4-chlorophenyl)thiazole
CAS:Formula:C9H7ClN2SPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:210.682-Amino-4-(4-chlorophenyl)thiazole, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H7ClN2SPurity:98%Color and Shape:Pale cream to cream to yellow to pale brown, Crystals or powder or crystalline powderMolecular weight:210.682-Thiazolamine, 4-(4-chlorophenyl)-
CAS:Formula:C9H7ClN2SPurity:94%Color and Shape:SolidMolecular weight:210.6833Histone acetyltransferase p300 Inhibitor 4c
CAS:2-Amino-4-(4-chlorophenyl)thiazole blocks hCA I/II, AChE, BChE with Ki: ~0.008, 0.124, 0.129, 0.083 µM.Formula:C9H7ClN2SPurity:99.76%Color and Shape:SolidMolecular weight:210.68Histone acetyltransferase p300 Inhibitor 4c
CAS:Histone acetyltransferase p300 Inhibitor 4cPurity:≥98%Molecular weight:210.68g/mol2-Amino-4-(4-chlorophenyl)thiazole
CAS:2-Amino-4-(4-chlorophenyl)thiazolePurity:98%Molecular weight:210.68g/mol4-(4-Chlorophenyl)thiazol-2-amine
CAS:Formula:C9H7ClN2SPurity:98%Color and Shape:SolidMolecular weight:210.682-Amino-4-(4-chlorophenyl)thiazole
CAS:2-Amino-4-(4-chlorophenyl)thiazole is an antibacterial agent that acts by inhibiting the synthesis of bacterial cell wall. It has a reactive group in the molecule that binds to the hydroxyl group of the glucose residue in peptidoglycan, preventing cross-linking and formation of new cell walls. 2-Amino-4-(4-chlorophenyl)thiazole is active against Gram positive bacteria such as Staphylococcus aureus, Streptococcus pyogenes, and Bacillus subtilis. This compound also inhibits the growth of Gram negative bacteria such as E. coli and Salmonella enterica. 2-Amino-4-(4-chlorophenyl)thiazole has been shown to be able to penetrate into cells and tissues, making it effective against some intracellular infection.
2-Amino-4-(4-chlorophenyl)thiazFormula:C9H7ClN2SPurity:Min. 95%Molecular weight:210.68 g/mol






