CAS 21034-22-0
:4-benzoyldihydrofuran-2(3H)-one
Description:
4-Benzoyldihydrofuran-2(3H)-one, also known as a derivative of dihydrofuran, is an organic compound characterized by its unique bicyclic structure that includes a furan ring and a carbonyl group. This compound typically appears as a white to pale yellow solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. Its molecular structure features a benzoyl group attached to the dihydrofuran ring, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the carbonyl group makes it susceptible to nucleophilic attack, allowing for various chemical transformations. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid inhalation or skin contact. Overall, 4-benzoyldihydrofuran-2(3H)-one is a versatile compound with potential applications in various fields of chemistry.
Formula:C11H10O3
InChI:InChI=1/C11H10O3/c12-10-6-9(7-14-10)11(13)8-4-2-1-3-5-8/h1-5,9H,6-7H2
SMILES:c1ccc(cc1)C(=O)C1CC(=O)OC1
Synonyms:- 2(3H)-furanone, 4-benzoyldihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
4-Benzoyldihydro-3H-furan-2-one
CAS:<p>4-Benzoyldihydro-3H-furan-2-one</p>Molecular weight:190.20g/mol4-benzoyldihydro-2(3H)-furanone
CAS:Controlled ProductFormula:C11H10O3Color and Shape:NeatMolecular weight:190.195


