
CAS 210353-54-1
:7-[(4E)-3-(Aminomethyl)-4-(methoxyimino)-1-pyrrolidinyl]-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylic acid
Description:
The chemical substance known as 7-[(4E)-3-(aminomethyl)-4-(methoxyimino)-1-pyrrolidinyl]-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylic acid, with the CAS number 210353-54-1, is a synthetic compound that belongs to the class of naphthyridine derivatives. It is characterized by a complex molecular structure that includes a naphthyridine core, which is fused with a cyclopropyl group and a fluorine atom, contributing to its unique pharmacological properties. The presence of an aminomethyl group and a methoxyimino moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of antimicrobial agents. The carboxylic acid functional group indicates that it may exhibit acidic properties, influencing its solubility and reactivity. Overall, this compound's structural features suggest it may possess significant biological activity, warranting further investigation for therapeutic applications.
Formula:C18H20FN5O4
InChI:InChI=1/C18H20FN5O4/c1-28-22-14-8-23(6-9(14)5-20)17-13(19)4-11-15(25)12(18(26)27)7-24(10-2-3-10)16(11)21-17/h4,7,9-10H,2-3,5-6,8,20H2,1H3,(H,26,27)/b22-14-
InChI key:InChIKey=ZRCVYEYHRGVLOC-HMAPJEAMNA-N
SMILES:O=C1C=2C(N(C=C1C(O)=O)C3CC3)=NC(=C(F)C2)N4C\C(=N\OC)\C(CN)C4
Synonyms:- 7-[(4E)-3-(Aminomethyl)-4-(methoxyimino)-1-pyrrolidinyl]-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylic acid
- 1,8-Naphthyridine-3-carboxylic acid, 7-[(4E)-3-(aminomethyl)-4-(methoxyimino)-1-pyrrolidinyl]-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-
- 7-(3-Aminomethyl)-4-methoxyimino-pyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-[1,8]naphthyridine-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
