CAS 21036-85-1

4-(3-methyl-1-benzothiophen-2-yl)-1,3-thiazol-2-amine

Description:

4-(3-methyl-1-benzothiophen-2-yl)-1,3-thiazol-2-amine, with the CAS number 21036-85-1, is an organic compound characterized by its unique structural features, which include a thiazole ring and a benzothiophene moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, which may include antimicrobial or anticancer effects, although specific biological data may vary. The presence of the thiazole and benzothiophene rings suggests that it may engage in π-π stacking interactions and exhibit fluorescence properties. Additionally, the methyl group on the benzothiophene can influence its solubility and reactivity. The compound is likely to be soluble in organic solvents and may have limited solubility in water due to its hydrophobic characteristics. Its synthesis and applications may be of interest in medicinal chemistry and material science, particularly in the development of novel pharmaceuticals or functional materials. As with any chemical substance, safety data and handling precautions should be reviewed before use.

Formula: C₁₂H₁₀N₂S₂

InChI: InChI=1/C12H10N2S2/c1-7-8-4-2-3-5-10(8)16-11(7)9-6-15-12(13)14-9/h2-6H,1H3,(H2,13,14)

SMILES: Cc1c2ccccc2sc1c1csc(=N)[nH]1

Synonyms:

• 4-(3-Methyl-1-Benzothien-2-Yl)-1,3-Thiazol-2-Amine

4-(3-Methyl-1-benzothien-2-yl)-1,3-thiazol-2-amine

CAS: 21036-85-1

Formula: C₁₂H₁₀N₂S₂

Molecular weight: 246.3512

Ref: IN-DA002KQY

4-(3-Methyl-1-benzothiophen-2-yl)-1,3-thiazol-2-amine

CAS: 21036-85-1

Versatile small molecule scaffold

Formula: C₁₂H₁₀N₂S₂

Purity: Min. 95%

Molecular weight: 246.4 g/mol

Ref: 3D-WAA03685