CAS 21038-66-4

Pyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione

Description:

Pyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione, with the CAS number 21038-66-4, is a heterocyclic organic compound characterized by a fused ring system that incorporates both pyridine and pyrimidine structures. This compound typically exhibits a bicyclic framework, which contributes to its unique chemical properties. It is known for its potential biological activity, often being investigated for its role in medicinal chemistry, particularly as a scaffold for drug development. The presence of the dione functional groups indicates that it can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding, which may enhance its reactivity and interaction with biological targets. Additionally, its structural features may influence its solubility, stability, and overall pharmacokinetic properties. Pyrido[2,3-d]pyrimidine derivatives are of interest in research due to their diverse applications, including anti-inflammatory, antiviral, and anticancer activities. As with many heterocycles, the specific characteristics can vary based on substituents and the overall molecular environment.

Formula: C₇H₅N₃O₂

InChI: InChI=1/C7H5N3O2/c11-6-4-2-1-3-8-5(4)9-7(12)10-6/h1-3H,(H2,8,9,10,11,12)

SMILES: c1cc2c(nc1)nc(nc2O)O

Synonyms:

• Nsc112519

Pyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione

CAS: 21038-66-4

Formula: C₇H₅N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 163.1335

Ref: IN-DA002KR8

Pyrido[2,3-d]pyrimidine-2,4(1h,3h)-dione

CAS: 21038-66-4

Pyrido[2,3-d]pyrimidine-2,4(1h,3h)-dione

Purity: 95%

Molecular weight: 163.13g/mol

Ref: 54-OR322574

Pyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione

CAS: 21038-66-4

Formula: C₇H₅N₃O₂

Purity: 98%

Color and Shape: Liquid, No data available.

Molecular weight: 163.136

Ref: 10-F235446

Pyrido[2,3-d]pyrimidine-2,4(1h,3h)-dione

CAS: 21038-66-4

Pyrido[2,3-d]pyrimidine-2,4(1h,3h)-dione is a synthetic molecule that has been shown to inhibit the production of necrosis factor alpha (TNFα) in human monocytes. Pyrido[2,3-d]pyrimidine-2,4(1h,3h)-dione has also been shown to cause DNA cleavage mediated by an aldehyde group. This chemical is being developed as an inhibitor of tumor necrosis factor and other cytokines with similar activities. Pyrido[2,3-d]pyrimidine-2,4(1h,3h)-dione is under investigation for its potential to prevent breast cancer metastasis. The molecule has been optimized for binding affinity and selectivity against TNFα and other cytokines with similar activity. Pyrido[2,3-d]pyrimidine-2,4(1h,3h)-d

Formula: C₇H₅N₃O₂

Purity: Min. 95%

Molecular weight: 163.14 g/mol

Ref: 3D-WAA03866