CymitQuimica logo

CAS 2104-11-2

:

2,4,5-triphenyl-1,3-thiazole

Description:
2,4,5-Triphenyl-1,3-thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features three phenyl groups attached to the 2, 4, and 5 positions of the thiazole ring, contributing to its distinctive properties. It typically exhibits a yellow to orange color and is known for its fluorescence, making it useful in various applications, including as a dye or in organic light-emitting diodes (OLEDs). The presence of multiple phenyl groups enhances its stability and solubility in organic solvents. Additionally, 2,4,5-triphenyl-1,3-thiazole can participate in various chemical reactions, including electrophilic substitutions and cycloadditions, due to the reactivity of the thiazole ring. Its unique structure and properties make it a subject of interest in materials science and organic chemistry research. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C21H15NS
InChI:InChI=1/C21H15NS/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)23-21(22-19)18-14-8-3-9-15-18/h1-15H
SMILES:c1ccc(cc1)c1c(c2ccccc2)sc(c2ccccc2)n1
Synonyms:
  • Thiazole, 2,4,5-Triphenyl-
  • Thiazole, triphenyl-
  • Triphenylthiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.