
CAS 21041-42-9
:(3R,4aR,5S,7R,8aS)-Decahydro-1,7-dimethyl-3,5-ethanoquinolin-10-one
Description:
The chemical substance known as (3R,4aR,5S,7R,8aS)-Decahydro-1,7-dimethyl-3,5-ethanoquinolin-10-one, with the CAS number 21041-42-9, is a bicyclic compound characterized by its complex stereochemistry and unique structural features. This compound belongs to the class of quinolines, which are nitrogen-containing heterocycles known for their diverse biological activities. The presence of multiple chiral centers contributes to its stereoisomerism, influencing its reactivity and interactions with biological systems. The dimethyl and ethano substituents enhance its hydrophobic character, which may affect its solubility and permeability in biological membranes. Additionally, the decahydro framework indicates that the compound is fully saturated, which typically results in increased stability compared to unsaturated analogs. Such compounds often exhibit interesting pharmacological properties, making them subjects of interest in medicinal chemistry and drug development. Overall, the unique structural and stereochemical characteristics of this compound suggest potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C13H21NO
InChI:InChI=1S/C13H21NO/c1-8-3-9-6-13(15)10-5-11(9)12(4-8)14(2)7-10/h8-12H,3-7H2,1-2H3/t8-,9+,10-,11-,12+/m1/s1
InChI key:InChIKey=PISGDLOMGNKHKP-ROHXPCBUSA-N
SMILES:CN1[C@@]2([C@]3([C@](CC(=O)[C@](C3)(C1)[H])(C[C@@H](C)C2)[H])[H])[H]
Synonyms:- 3,5-Ethanoquinolin-10-one, decahydro-1,7-dimethyl-, (3R,4aR,5S,7R,8aS)-
- Luciduline
- 3,5-Ethanoquinolin-10-one, decahydro-1,7-dimethyl-, [3R-(3α,4aβ,5α,7β,8aβ)]-
- (3R,4aR,5S,7R,8aS)-Decahydro-1,7-dimethyl-3,5-ethanoquinolin-10-one
- (+)-Luciduline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Luciduline
CAS:Luciduline is a bioactive chemical.Formula:C13H21NOColor and Shape:SolidMolecular weight:207.317
