CAS 21043-42-5
:Cycloheptylpiperazine
Description:
Cycloheptylpiperazine is a cyclic organic compound characterized by a piperazine ring substituted with a cycloheptyl group. Its molecular structure consists of a six-membered piperazine ring, which contains two nitrogen atoms, and a seven-membered cycloheptyl ring attached to it. This compound is typically colorless to pale yellow and may exhibit a faint odor. Cycloheptylpiperazine is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. It is soluble in organic solvents but has limited solubility in water. The compound's properties, such as boiling point, melting point, and density, can vary based on purity and specific conditions. As with many piperazine derivatives, cycloheptylpiperazine may exhibit psychoactive effects and has been studied for its potential use in treating neurological disorders. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C11H22N2
InChI:InChI=1/C11H22N2/c1-2-4-6-11(5-3-1)13-9-7-12-8-10-13/h11-12H,1-10H2
SMILES:C1CCCC(CC1)N1CCNCC1
Synonyms:- 1-Cycloheptylpiperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(Cycloheptyl)piperazine
CAS:1-(Cycloheptyl)piperazineFormula:C11H22N2Purity:98%Color and Shape: yellow to brown liquidMolecular weight:182.31g/mol(1-Cycloheptyl)piperazine
CAS:Formula:C11H22N2Purity:98.0%Color and Shape:Liquid, OilMolecular weight:182.3111-Cycloheptylpiperazine
CAS:<p>1-Cycloheptylpiperazine is a drug substance that can be used as an active ingredient in medicines. It is used to treat inflammatory diseases, such as psoriasis, and neurodegenerative diseases, such as Parkinson's disease. 1-Cycloheptylpiperazine has a liposomal formulation and is soluble in organic solvents. The compound has been shown to be bioactive when administered at high doses and may have therapeutic effects on cardiovascular diseases, cancer and adp-ribose metabolism.</p>Formula:C11H22N2Purity:Min. 95%Molecular weight:182.31 g/mol



