
CAS 210580-75-9: 1-[(2S)-2-Aminopropyl]-1H-indazol-6-ol
Description:1-[(2S)-2-Aminopropyl]-1H-indazol-6-ol, with the CAS number 210580-75-9, is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of the amino group (-NH2) and the hydroxyl group (-OH) contributes to its potential as a biologically active molecule. This compound is typically classified as an indazole derivative, which may exhibit various pharmacological properties, including potential roles in neurochemistry or as a therapeutic agent. Its stereochemistry, indicated by the (2S) configuration, suggests specific spatial arrangements that can influence its biological activity and interactions with receptors or enzymes. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 1-[(2S)-2-Aminopropyl]-1H-indazol-6-ol represents a class of compounds that may be of interest in medicinal chemistry and drug development due to their structural features and potential biological effects.
Formula:C10H13N3O
InChI:InChI=1S/C10H13N3O/c1-7(11)6-13-10-4-9(14)3-2-8(10)5-12-13/h2-5,7,14H,6,11H2,1H3/t7-/m0/s1
InChI key:InChIKey=WBYHTZYHAFNBKW-ZETCQYMHSA-N
SMILES:OC=1C=CC=2C=NN(C2C1)CC(N)C
- Synonyms:
- 1-((S)-2-Aminopropyl)-1H-indazol-6-ol
- 1H-Indazol-6-ol, 1-[(2S)-2-aminopropyl]-
- 1H-Indazol-6-ol 1-[(2S)-2-aminopropyl]-
- 1-[(2S)-2-Aminopropyl]-1H-indazol-6-ol

1H-Indazol-6-ol, 1-[(2S)-2-aminopropyl]-
Ref: IN-DA002KVV
1mg | 100.00 € | ||
5mg | 194.00 € |

Ref: 54-BUP01876
25mg | 336.00 € | ||
100mg | 779.00 € | ||
200mg | 1,391.00 € |

AL 34662
Ref: TM-T22029
1mg | 42.00 € | ||
5mg | 88.00 € | ||
10mg | 127.00 € | ||
25mg | 216.00 € |

1-((S)-2-Amino-propyl)-1H-indazol-6-ol
Ref: 3D-KIA58075
50mg | 879.00 € | ||
100mg | 1,324.00 € |