CAS 2106-10-7
:1-fluoro-1-deoxy-A-D-glucose
Description:
1-Fluoro-1-deoxy-D-glucose is a modified monosaccharide that features a fluorine atom substituted at the anomeric carbon (C-1) of the glucose molecule, replacing the hydroxyl group typically found in D-glucose. This substitution alters its chemical properties and biological activity. The presence of the fluorine atom can influence the molecule's reactivity, stability, and interaction with enzymes, making it of interest in biochemical research and potential pharmaceutical applications. The compound is typically a white crystalline solid and is soluble in water, reflecting the polar nature of its hydroxyl groups. Its structure allows it to participate in various chemical reactions, including those involving glycosylation and phosphorylation. Additionally, 1-fluoro-1-deoxy-D-glucose can serve as a useful tracer in metabolic studies due to its ability to mimic glucose while providing distinct pathways for detection and analysis. Overall, this compound exemplifies how small modifications to carbohydrate structures can lead to significant changes in their chemical behavior and biological functions.
Formula:C6H11FO5
InChI:InChI=1/C6H11FO5/c7-6-5(11)4(10)3(9)2(1-8)12-6/h2-6,8-11H,1H2/t2-,3-,4+,5-,6?/m1/s1
Synonyms:- Glucosyl fluoride
- alpha-D-Glucopyranosyl fluoride
- D-glucopyranosyl fluoride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2R,3R,4S,5S,6R)-2-Fluoro-6-(Hydroxymethyl)Tetrahydro-2H-Pyran-3,4,5-Triol
CAS:<p>(2R,3R,4S,5S,6R)-2-Fluoro-6-(Hydroxymethyl)Tetrahydro-2H-Pyran-3,4,5-Triol</p>Purity:97%Molecular weight:182.15g/mola-D-Glucopyranosyl fluoride
CAS:<p>a-D-Glucopyranosyl fluoride is an irreversible inhibitor of the enzyme glycosidase. This product has been used to study the kinetic and mechanism of human serum alpha-glucosidase, which is a key enzyme in the digestion of carbohydrates. Kinetic studies have shown that 4-hydroxycinnamic acid and glucose are competitive inhibitors of the enzyme. The reaction mechanism for this product involves hydrogen fluoride cleavage of the glycosidic bond. The optimum pH for this product is 7.</p>Formula:C6H11FO5Purity:Min. 95%Color and Shape:White PowderMolecular weight:182.15 g/mol
