CAS 21061-10-9: cis-8,11,14-eicosatrienoic acid methyl*ester
Description:Cis-8,11,14-eicosatrienoic acid methyl ester, also known as methyl eicosatrienoate, is a fatty acid methyl ester derived from eicosatrienoic acid, which is a polyunsaturated fatty acid. This compound features three double bonds located at the 8th, 11th, and 14th carbon positions in the carbon chain, with the "cis" configuration indicating the orientation of these double bonds. It is typically a colorless to pale yellow liquid at room temperature and is soluble in organic solvents. The presence of multiple double bonds contributes to its reactivity and potential health benefits, as polyunsaturated fatty acids are known for their role in human nutrition and cellular functions. Methyl eicosatrienoate is often studied for its potential applications in biochemistry and nutrition, particularly in relation to its effects on lipid metabolism and cardiovascular health. Additionally, it may serve as a precursor in the synthesis of various bioactive compounds. As with many fatty acid derivatives, it is important to handle this compound with care, considering its reactivity and potential biological effects.
Formula:C21H36O2
InChI:InChI=1/C21H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h7-8,10-11,13-14H,3-6,9,12,15-20H2,1-2H3/b8-7-,11-10-,14-13-
- Synonyms:
- Methyl Icosa-8,11,14-Trienoate
- methyl (8Z,11Z,14Z)-icosa-8,11,14-trienoate
