CAS 210644-65-8

Ethyl 2-[(Z)-(1,2-dihydro-2-oxo-3H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrole-3-propanoate

Description:

Ethyl 2-[(Z)-(1,2-dihydro-2-oxo-3H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrole-3-propanoate, with the CAS number 210644-65-8, is a chemical compound characterized by its complex structure, which includes a pyrrole ring and an indole derivative. This compound typically exhibits properties associated with both heterocyclic compounds and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the carbonyl and ester moieties. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic additions and cycloadditions, making it of interest in synthetic organic chemistry. Additionally, compounds with similar structures often display biological activity, which could make this substance relevant in medicinal chemistry or pharmacology. However, specific biological properties and applications would require further investigation through empirical studies. Overall, the compound's unique structural features contribute to its potential utility in various chemical and pharmaceutical applications.

Formula: C₁₉H₂₀N₂O₃

InChI: InChI=1S/C19H20N2O3/c1-3-24-18(22)9-8-13-12(2)11-20-17(13)10-15-14-6-4-5-7-16(14)21-19(15)23/h4-7,10-11,20H,3,8-9H2,1-2H3,(H,21,23)/b15-10-

InChI key: InChIKey=MZJWAAUWSPTDQB-GDNBJRDFSA-N

SMILES: C(=C\1/C=2C(NC1=O)=CC=CC2)\C3=C(CCC(OCC)=O)C(C)=CN3

Synonyms:

• 1H-Pyrrole-3-propanoic acid, 2-[(Z)-(1,2-dihydro-2-oxo-3H-indol-3-ylidene)methyl]-4-methyl-, ethyl ester
• Ethyl 2-[(Z)-(1,2-dihydro-2-oxo-3H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrole-3-propanoate

SU-5402 Ethyl Ester

Controlled Product

CAS: 210644-65-8

Applications Byproduct formed during the synthesis of SU 5402

Formula: C₁₉H₂₀N₂O₃

Color and Shape: Neat

Molecular weight: 324.37

Ref: TR-S688015