CymitQuimica logo

CAS 210686-41-2

:

4-[4-(diphenylmethoxy)piperidin-1-yl]-1-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]butan-1-one

Description:
The chemical substance known as 4-[4-(diphenylmethoxy)piperidin-1-yl]-1-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]butan-1-one, with the CAS number 210686-41-2, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring and multiple aromatic groups. This compound typically exhibits properties associated with its functional groups, such as potential lipophilicity due to the presence of aromatic rings and a hydrophilic hydroxyl group that may influence its solubility in various solvents. The presence of a ketone functional group suggests reactivity in certain chemical reactions, such as nucleophilic additions. Additionally, the compound may possess biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific characteristics, including melting point, boiling point, and spectral data (NMR, IR, MS), would be determined through experimental methods and may vary based on purity and environmental conditions. Overall, this compound represents a class of molecules that could be explored for therapeutic applications.
Formula:C32H39NO3
InChI:InChI=1/C32H39NO3/c1-32(2,24-34)28-17-15-25(16-18-28)30(35)14-9-21-33-22-19-29(20-23-33)36-31(26-10-5-3-6-11-26)27-12-7-4-8-13-27/h3-8,10-13,15-18,29,31,34H,9,14,19-24H2,1-2H3
SMILES:CC(C)(CO)c1ccc(cc1)C(=O)CCCN1CCC(CC1)OC(c1ccccc1)c1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.