CAS 2107-43-9

Benzenamine, 3-fluoro-2,4-dimethyl-

Description:

Benzenamine, 3-fluoro-2,4-dimethyl- (CAS 2107-43-9) is an organic compound characterized by its aromatic amine structure, which features a benzene ring substituted with an amino group and multiple alkyl and halogen substituents. The presence of the fluoro group at the meta position relative to the amino group, along with two methyl groups at the ortho and para positions, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the aromatic ring and alkyl groups. Benzenamine derivatives are often utilized in the synthesis of dyes, pharmaceuticals, and agrochemicals, owing to their reactivity and ability to participate in various chemical reactions, such as electrophilic aromatic substitution. Safety precautions should be taken when handling this compound, as it may pose health risks, including skin and respiratory irritation.

Formula: C₈H₁₀FN

InChI: InChI=1/C8H10FN/c1-5-3-4-7(10)6(2)8(5)9/h3-4H,10H2,1-2H3

SMILES: Cc1ccc(c(C)c1F)N

Synonyms:

• 3-Fluoro-2,4-dimethylaniline3-Fluoro-N,N-dimethylaniline

Benzenamine, 3-fluoro-N,N-dimethyl-

CAS: 2107-43-9

Formula: C₈H₁₀FN

Purity: 98%

Color and Shape: Liquid

Molecular weight: 139.1701

Ref: IN-DA002KXQ

1-(Dimethylamino)-3-fluorobenzene

CAS: 2107-43-9

1-(Dimethylamino)-3-fluorobenzene

Purity: 97%

Molecular weight: 139.17g/mol

Ref: 54-PC7857

3-Fluoro-N,N-dimethylaniline

CAS: 2107-43-9

Purity: 98%

Molecular weight: 139.17

Ref: 10-F790827