CAS 2107-77-9
:7,8-Dihydroxy-4-methylcoumarin
Description:
7,8-Dihydroxy-4-methylcoumarin, with the CAS number 2107-77-9, is a chemical compound belonging to the coumarin family, characterized by its fused benzene and α-pyrone rings. This compound features two hydroxyl groups at the 7 and 8 positions and a methyl group at the 4 position, which contribute to its unique chemical properties. It is typically a pale yellow to white crystalline solid, exhibiting solubility in organic solvents such as ethanol and dimethyl sulfoxide, while being less soluble in water. 7,8-Dihydroxy-4-methylcoumarin is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in pharmaceutical and cosmetic applications. Its structure allows for various chemical reactions, including esterification and oxidation, which can be exploited in synthetic organic chemistry. Additionally, it may serve as a fluorescent probe in biochemical studies due to its ability to absorb and emit light at specific wavelengths. Overall, this compound is significant in both research and practical applications due to its diverse functional properties.
Formula:C10H8O4
InChI:InChI=1S/C10H8O4/c1-5-4-8(12)14-10-6(5)2-3-7(11)9(10)13/h2-4,11,13H,1H3
InChI key:InChIKey=NWQBYMPNIJXFNQ-UHFFFAOYSA-N
SMILES:CC=1C=2C(=C(O)C(O)=CC2)OC(=O)C1
Synonyms:- 2H-1-Benzopyran-2-one, 7,8-dihydroxy-4-methyl-
- 4-Methyl-7,8-dihydroxycoumarin
- 4-Methyldaphnetin
- 7,8-Dihydroxy-4-methyl-2H-1-benzopyran-2-one
- 7,8-Dihydroxy-4-methyl-chromen-2-one
- 7,8-dihydroxy-4-methyl-2H-chromen-2-one
- Coumarin, 7,8-dihydroxy-4-methyl-
- NSC 45795
- NSC 72276
- 7,8-Dihydroxy-4-methylcoumarin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
7,8-Dihydroxy-4-methylcoumarin
CAS:Formula:C10H8O4Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:192.177,8-Dihydroxy-4-methylcoumarin, 97%
CAS:<p>Can be used as a fluorescent sensor to monitor the consumption of a boronic acid in a Suzuki cross-coupling reaction. Use a long wave UV lamp. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to</p>Formula:C10H8O4Purity:97%Color and Shape:Powder, White to pale brownMolecular weight:192.172H-1-Benzopyran-2-one, 7,8-dihydroxy-4-methyl-
CAS:Formula:C10H8O4Purity:95%Color and Shape:SolidMolecular weight:192.16817,8-Dihydroxy-4-methylcoumarin
CAS:7,8-Dihydroxy-4-methylcoumarinPurity:98%Molecular weight:192.17g/mol4-Methyldaphnetin
CAS:<p>4-Methyldaphnetin (DHMC) is a potent inhibitor of lipid peroxidation and scavengers of superoxide anion radicals and of aqueous alkylperoxyl radicals.</p>Formula:C10H8O4Purity:99.73%Color and Shape:SolidMolecular weight:192.177,8-Dihydroxy-4-methylcoumarin
CAS:<p>7,8-Dihydroxy-4-methylcoumarin is a bioactive compound, specifically a derivative of coumarin. This compound is naturally derived from plant sources, where it acts as a metabolite in various biochemical pathways. Its chemical structure is characterized by the presence of two hydroxyl groups at the 7 and 8 positions, along with a methyl group at the 4 position of the coumarin core, contributing to its unique pharmacological profile.</p>Formula:C10H8O4Purity:Min. 95%Molecular weight:192.17 g/mol








