CAS 21076-23-3
:N-benzyl-1-methylhydrazinecarbothioamide
Description:
N-benzyl-1-methylhydrazinecarbothioamide is an organic compound characterized by the presence of a hydrazine functional group, a benzyl moiety, and a carbothioamide group. This compound typically exhibits properties associated with both hydrazines and thioamides, such as potential reactivity due to the presence of the hydrazine nitrogen atoms, which can participate in nucleophilic reactions. The benzyl group contributes to the compound's hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the carbothioamide functional group may impart specific biological activities, making it of interest in medicinal chemistry. The compound's structure suggests it could engage in hydrogen bonding due to the presence of the amide nitrogen and sulfur, affecting its physical properties and reactivity. Overall, N-benzyl-1-methylhydrazinecarbothioamide is a compound with potential applications in various fields, including pharmaceuticals and agrochemicals, although specific biological activities and applications would require further investigation.
Formula:C9H13N3S
InChI:InChI=1/C9H13N3S/c1-12(10)9(13)11-7-8-5-3-2-4-6-8/h2-6H,7,10H2,1H3,(H,11,13)
SMILES:CN(C(=NCc1ccccc1)S)N
Synonyms:- 3-amino-1-benzyl-3-methylthiourea
- Hydrazinecarbothioamide, 1-methyl-N-(phenylmethyl)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Amino-1-benzyl-3-methylthiourea
CAS:<p>3-Amino-1-benzyl-3-methylthiourea (MBT) is a cationic organosulfur compound with a trifluoroacetic acid moiety. It is also known as 3-aminobenzyl methylthiocarbamate or 3,3'-diacetylbenzyl methylthiocarbamate. MBT is a cyclized product of trifluoroacetic acid and phenylglyoxal, which has been used in the synthesis of various organic compounds. The chemical properties of MBT are similar to those of diacetyl and acetaldehyde, but it does not have the unpleasant odor associated with these substances. In addition, MBT does not react with proteins and is less toxic than other carbonyl compounds.</p>Formula:C9H13N3SPurity:Min. 95%Molecular weight:195.29 g/mol

