CAS 21079-31-2
:(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)acetic acid
Description:
The chemical substance known as (7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)acetic acid, with the CAS number 21079-31-2, is a pteridine derivative characterized by its complex bicyclic structure. This compound features a pteridin core, which is a fused bicyclic system containing nitrogen atoms, contributing to its unique chemical properties. The presence of two methyl groups at the 7 and 8 positions enhances its hydrophobic characteristics, while the dioxo groups at the 2 and 4 positions indicate the presence of carbonyl functionalities, which can participate in various chemical reactions, including hydrogen bonding and coordination with metal ions. The acetic acid moiety adds a carboxylic acid functional group, which is polar and can engage in hydrogen bonding, influencing the compound's solubility and reactivity. Overall, this substance may exhibit biological activity, potentially serving as a precursor or intermediate in pharmaceutical applications, although specific biological properties would require further investigation.
Formula:C14H12N4O4
InChI:InChI=1/C14H12N4O4/c1-6-3-8-9(4-7(6)2)18(5-10(19)20)12-11(15-8)13(21)17-14(22)16-12/h3-4H,5H2,1-2H3,(H,19,20)(H,17,21,22)
SMILES:Cc1cc2c(cc1C)n(CC(=O)O)c1c(c(nc(=O)n1)O)n2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Benzo[g]pteridine-10(2H)-acetic acid, 3,4-dihydro-7,8-dimethyl-2,4-dioxo-
CAS:Formula:C14H12N4O4Molecular weight:300.2695

