CAS 21080-66-0
:(3S,4S,5S,6R)-6-(4-aminophenoxy)-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid
Description:
The chemical substance known as "(3S,4S,5S,6R)-6-(4-aminophenoxy)-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid," with the CAS number 21080-66-0, is a complex organic compound characterized by its tetrahydropyran ring structure, which features multiple hydroxyl groups and a carboxylic acid functional group. The stereochemistry indicated by the (3S,4S,5S,6R) configuration suggests specific spatial arrangements of the atoms, which can significantly influence the compound's biological activity and interactions. The presence of the 4-aminophenoxy group contributes to its potential as a pharmacophore, possibly enhancing its solubility and reactivity. This compound may exhibit properties such as being a potential ligand or inhibitor in biochemical pathways, making it of interest in medicinal chemistry and drug development. Its trihydroxy and carboxylic acid functionalities suggest it could participate in hydrogen bonding and ionic interactions, which are crucial for its biological efficacy. Overall, this compound's unique structural features position it as a candidate for further research in various chemical and pharmaceutical applications.
Formula:C12H15NO7
InChI:InChI=1/C12H15NO7/c13-5-1-3-6(4-2-5)19-12-9(16)7(14)8(15)10(20-12)11(17)18/h1-4,7-10,12,14-16H,13H2,(H,17,18)/t7-,8-,9-,10?,12-/m0/s1
SMILES:c1cc(ccc1N)O[C@@H]1[C@H]([C@H]([C@@H](C(C(=O)O)O1)O)O)O
Synonyms:- 4-AMinophenyl β-D-Glucuronide SodiuM Salt
- 4-Aminophenyl b-D-glucuronide Sodium Salt
- 4-AMinophenyl β-D-Glucopyranosiduronic Acid
- 4-Aminophenyl -D-Glucuronide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Aminophenyl β-D-glucuronide sodium
CAS:4-Aminophenyl β-D-Glucuronide can be used to analyse acetaminophen and other metabolites in plasma.Formula:C12H14NO7•NaPurity:Min. 95%Color and Shape:PowderMolecular weight:307.23 g/mol4-Aminophenyl β-D-glucuronide
CAS:4-Aminophenyl b-D-glucuronide sodium is a glycosylation reagent used in the synthesis of complex carbohydrates, polysaccharides and oligosaccharides.
Formula:C12H15NO7Purity:Min. 95%Molecular weight:285.25 g/mol

