CAS 21080-66-0

(3S,4S,5S,6R)-6-(4-aminophenoxy)-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid

Description:

The chemical substance known as "(3S,4S,5S,6R)-6-(4-aminophenoxy)-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid," with the CAS number 21080-66-0, is a complex organic compound characterized by its tetrahydropyran ring structure, which features multiple hydroxyl groups and a carboxylic acid functional group. The stereochemistry indicated by the (3S,4S,5S,6R) configuration suggests specific spatial arrangements of the atoms, which can significantly influence the compound's biological activity and interactions. The presence of the 4-aminophenoxy group contributes to its potential as a pharmacophore, possibly enhancing its solubility and reactivity. This compound may exhibit properties such as being a potential ligand or inhibitor in biochemical pathways, making it of interest in medicinal chemistry and drug development. Its trihydroxy and carboxylic acid functionalities suggest it could participate in hydrogen bonding and ionic interactions, which are crucial for its biological efficacy. Overall, this compound's unique structural features position it as a candidate for further research in various chemical and pharmaceutical applications.

Formula: C₁₂H₁₅NO₇

InChI: InChI=1/C12H15NO7/c13-5-1-3-6(4-2-5)19-12-9(16)7(14)8(15)10(20-12)11(17)18/h1-4,7-10,12,14-16H,13H2,(H,17,18)/t7-,8-,9-,10?,12-/m0/s1

SMILES: c1cc(ccc1N)O[C@@H]1[C@H]([C@H]([C@@H](C(C(=O)O)O1)O)O)O

Synonyms:

• 4-AMinophenyl β-D-Glucuronide SodiuM Salt
• 4-Aminophenyl b-D-glucuronide Sodium Salt
• 4-AMinophenyl β-D-Glucopyranosiduronic Acid
• 4-Aminophenyl -D-Glucuronide

4-Aminophenyl β-D-glucuronide

CAS: 21080-66-0

Formula: C₁₂H₁₅NO₇

Color and Shape: Solid

Molecular weight: 285.2500

Ref: IN-DA002KZP

4-Aminophenyl β-D-glucuronide

CAS: 21080-66-0

4-Aminophenyl b-D-glucuronide sodium is a glycosylation reagent used in the synthesis of complex carbohydrates, polysaccharides and oligosaccharides.

Formula: C₁₂H₁₅NO₇

Purity: Min. 95%

Molecular weight: 285.25 g/mol

Ref: 3D-J-013824

4-Aminophenyl β-D-glucuronide sodium

CAS: 21080-66-0

4-Aminophenyl β-D-Glucuronide can be used to analyse acetaminophen and other metabolites in plasma.

Formula: C₁₂H₁₄NO₇•Na

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 307.23 g/mol

Ref: 3D-MA04485