CAS 21080-91-1

3-Cyclopropyl-1,2-oxazol-5-amine

Description:

3-Cyclopropyl-1,2-oxazol-5-amine is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopropyl group and an oxazole ring. The oxazole moiety is a five-membered heterocyclic ring containing both nitrogen and oxygen, contributing to the compound's potential biological activity. This compound typically exhibits properties such as moderate solubility in polar solvents and may participate in various chemical reactions due to the presence of the amine functional group. The cyclopropyl group can influence the compound's reactivity and steric properties, potentially affecting its interactions with biological targets. 3-Cyclopropyl-1,2-oxazol-5-amine may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the design of compounds with specific pharmacological activities. Its structural characteristics suggest that it could be involved in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile building block in organic synthesis.

Formula: C₆H₈N₂O

InChI: InChI=1S/C6H8N2O/c7-6-3-5(8-9-6)4-1-2-4/h3-4H,1-2,7H2

SMILES: C1CC1c1cc(N)on1

3-Cyclopropylisoxazol-5-amine

CAS: 21080-91-1

Formula: C₆H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 124.1405

Ref: IN-DA00BGHF

3-Cyclopropylisoxazol-5-amine

CAS: 21080-91-1

3-Cyclopropylisoxazol-5-amine

Purity: 98%

Molecular weight: 124.14052g/mol

Ref: 54-OR77191

3-Cyclopropylisoxazol-5-amine

CAS: 21080-91-1

Formula: C₆H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 124.143

Ref: 10-F062553