CAS 210825-11-9

1-phenyl-3-(thiophen-2-yl)-1H-pyrazole-4-carbaldehyde

Description:

1-Phenyl-3-(thiophen-2-yl)-1H-pyrazole-4-carbaldehyde is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a phenyl group and a thiophene ring, contributing to its aromatic properties and potential for various chemical interactions. The presence of the aldehyde functional group (-CHO) at the 4-position of the pyrazole ring indicates that it can participate in further chemical reactions, such as condensation or oxidation. The compound is likely to exhibit interesting biological activities due to the combination of the pyrazole, phenyl, and thiophene moieties, which are known for their roles in pharmaceuticals and agrochemicals. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's solubility and stability may vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 1-phenyl-3-(thiophen-2-yl)-1H-pyrazole-4-carbaldehyde represents a versatile scaffold for further chemical exploration.

Formula: C₁₄H₁₀N₂OS

InChI: InChI=1/C14H10N2OS/c17-10-11-9-16(12-5-2-1-3-6-12)15-14(11)13-7-4-8-18-13/h1-10H

SMILES: c1ccc(cc1)n1cc(C=O)c(c2cccs2)n1

Synonyms:

• 1H-pyrazole-4-carboxaldehyde, 1-phenyl-3-(2-thienyl)-
• 1-phenyl-3-(2-thienyl)-1H-pyrazole-4-carbaldehyde
• Pyrazole-4-carboxaldehyde, 1-phenyl-3-(2-thienyl)-
• 1-Phenyl-3-thiophen-2-yl-1H-pyrazole-4-carbaldehyde

1-Phenyl-3-(2-thienyl)-1h-pyrazole-4-carbaldehyde

CAS: 210825-11-9

Formula: C₁₄H₁₀N₂OS

Purity: 97%

Color and Shape: Solid

Molecular weight: 254.3070

Ref: IN-DA002KZ6

1-Phenyl-3-(thiophen-2-yl)-1H-pyrazole-4-carbaldehyde

CAS: 210825-11-9

1-Phenyl-3-(thiophen-2-yl)-1H-pyrazole-4-carbaldehyde

Purity: 97%

Molecular weight: 254.31g/mol

Ref: 54-OR1042440

1-Phenyl-3-(thiophen-2-yl)-1H-pyrazole-4-carbaldehyde

CAS: 210825-11-9

Purity: 95.0%

Molecular weight: 254.30999755859375

Ref: 10-F234047