CAS 21083-47-6
:5,5-Diphenyl-2-thiohydantoin
Description:
5,5-Diphenyl-2-thiohydantoin is an organic compound characterized by its thiohydantoin structure, which features a five-membered ring containing both nitrogen and sulfur atoms. This compound is typically recognized for its role in organic synthesis and as a reagent in various chemical reactions, particularly in the field of medicinal chemistry. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many thiohydantoins. The presence of two phenyl groups contributes to its stability and influences its reactivity, making it useful in the synthesis of other complex molecules. Additionally, 5,5-Diphenyl-2-thiohydantoin can participate in nucleophilic substitution reactions due to the electrophilic nature of the carbonyl group in the thiohydantoin framework. Its applications may extend to the development of pharmaceuticals, where it can serve as a building block or a functional group in drug design. As with many chemical substances, handling should be done with care, adhering to safety protocols to mitigate any potential hazards.
Formula:C15H12N2OS
InChI:InChI=1/C15H12N2OS/c18-13-15(17-14(19)16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18,19)
InChI key:InChIKey=AMDPNECWKZZEBQ-UHFFFAOYSA-N
SMILES:O=C1C(NC(=S)N1)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 4-Imidazolidinone, 5,5-diphenyl-2-thioxo-
- 5,5-Diphenyl-2-thioxo-4-imidazolidinone
- 5,5-Diphenyl-2-thioxoimidazolidin-4-one
- 5,5-Diphenylimidazolidine-4-one-2-thione
- 5,5-Diphenylthiohydantoin
- Ai3-52493
- Brn 0229988
- Diphenylthiohydantoin
- Dpth
- Hydantoin, 5,5-diphenyl-2-thio-
- Nsc 82311
- 5,5-Diphenyl-2-thiohydantoin
- 5,5-Diphenyl-2-thiohydantoin
- 5-24-08-00403 (Beilstein Handbook Reference)
- 5,5-diphenyl-2-thioxo-4-imidazolidinon
- 5,5-diphenyl-2-thio-hydantoi
- 5,5-diphenyl-2-sulfanylideneimidazolidin-4-one
- Hydantoin Impurity 14
- 5,5-Diphenyl-2-thiohydantoin,99%
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
5,5-Diphenyl-2-thiohydantoin
CAS:Controlled ProductApplications 5,5-Diphenyl-2-thiohydantoin is a reactant for synthesis of imidazole derivatives.
Formula:C15H12N2OSColor and Shape:NeatMolecular weight:268.334


