CAS 210834-98-3

4-chloro-6-fluoro-1,3-benzothiazol-2-amine

Description:

4-Chloro-6-fluoro-1,3-benzothiazol-2-amine is a chemical compound characterized by its unique structure, which includes a benzothiazole ring system substituted with chlorine and fluorine atoms, as well as an amino group. This compound typically exhibits properties associated with heterocyclic aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group. The chlorine and fluorine substituents can influence its electronic properties, making it a candidate for various applications in pharmaceuticals and agrochemicals. The presence of the benzothiazole moiety often imparts biological activity, which may include antimicrobial or anticancer properties. Additionally, the compound's stability and reactivity can be affected by environmental factors, making it important to consider its handling and storage conditions. Overall, 4-chloro-6-fluoro-1,3-benzothiazol-2-amine is of interest in chemical research and development due to its potential utility in various fields.

Formula: C₇H₄ClFN₂S

InChI: InChI=1/C7H4ClFN2S/c8-4-1-3(9)2-5-6(4)11-7(10)12-5/h1-2H,(H2,10,11)

SMILES: c1c(cc2c(c1Cl)[nH]c(=N)s2)F

Synonyms:

• 2-Benzothiazolamine, 4-chloro-6-fluoro-

2-Amino-4-chloro-6-fluorobenzothiazole

CAS: 210834-98-3

Formula: C₇H₄ClFN₂S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 202.63

Ref: 10-F033445